CAS 1448858-56-7 appears in our catalog under these names: 4-Nitro-2-(trifluoromethyl)benzene-1,3-diamine, 95%, 4-Nitro-2-(trifluoromethyl)benzene-1,3-diamine, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
4-nitro-2-(trifluoromethyl)benzene-1,3-diamine (CAS 1448858-56-7) is a chemical compound with the molecular formula C7H6F3N3O2 and a molecular weight of 221.14 g/mol. IUPAC name: 4-nitro-2-(trifluoromethyl)benzene-1,3-diamine. InChIKey: KASLVFUMBDUPCY-UHFFFAOYSA-N.
| Molecular formula | C7H6F3N3O2 |
|---|---|
| Molecular weight | 221.14 g/mol |
| IUPAC name | 4-nitro-2-(trifluoromethyl)benzene-1,3-diamine |
| InChIKey | KASLVFUMBDUPCY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1N)C(F)(F)F)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)