Products 1448896-43-2
CAS 1448896-43-2 is the registry number for 1-(5-Bromopyridin-3-yl)-2,2,2-trifluoroethane-1,1-diol. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-(5-bromo-3-pyridinyl)-2,2,2-trifluoroethane-1,1-diol (CAS 1448896-43-2) is a chemical compound with the molecular formula C7H5BrF3NO2 and a molecular weight of 272.02 g/mol. IUPAC name: 1-(5-bromo-3-pyridinyl)-2,2,2-trifluoroethane-1,1-diol. InChIKey: VVADTYSQMRWSOY-UHFFFAOYSA-N.
| Molecular formula | C7H5BrF3NO2 |
|---|---|
| Molecular weight | 272.02 g/mol |
| IUPAC name | 1-(5-bromo-3-pyridinyl)-2,2,2-trifluoroethane-1,1-diol |
| InChIKey | VVADTYSQMRWSOY-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC=C1Br)C(C(F)(F)F)(O)O |
Computed by PubChem (NCBI)