CAS 1448999-68-5 is the registry number for Purine Related Compound 1. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (3R)-3-[6-(dibenzylamino)-8-oxo-7H-purin-9-yl]piperidine-1-carboxylate (CAS 1448999-68-5) is a chemical compound with the molecular formula C29H34N6O3 and a molecular weight of 514.6 g/mol. IUPAC name: tert-butyl (3R)-3-[6-(dibenzylamino)-8-oxo-7H-purin-9-yl]piperidine-1-carboxylate. InChIKey: PJKMBBAVHCKAOY-HSZRJFAPSA-N.
| Molecular formula | C29H34N6O3 |
|---|---|
| Molecular weight | 514.6 g/mol |
| IUPAC name | tert-butyl (3R)-3-[6-(dibenzylamino)-8-oxo-7H-purin-9-yl]piperidine-1-carboxylate |
| InChIKey | PJKMBBAVHCKAOY-HSZRJFAPSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H](C1)N2C3=C(C(=NC=N3)N(CC4=CC=CC=C4)CC5=CC=CC=C5)NC2=O |
Computed by PubChem (NCBI)