CAS 1449-46-3 appears in our catalog under these names: Benzyltriphenylphosphonium bromide, Benzyltriphenylphosphonium bromide, Benzyltriphenylphosphonium bromide, 98% , Benzyltriphenylphosphonium Bromide, >98.0%(HPLC)(T), Benzyl triphenyl phosphonium bromide. Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, TCI. Available pack sizes: 10g, 1g, 5g, 250g, 500g, 50g, 0,25g, 2,5g.
Benzyl(triphenyl)phosphanium bromide (CAS 1449-46-3) is a chemical compound with the molecular formula C25H22BrP and a molecular weight of 433.3 g/mol. IUPAC name: benzyl(triphenyl)phosphanium bromide. InChIKey: WTEPWWCRWNCUNA-UHFFFAOYSA-M.
| Molecular formula | C25H22BrP |
|---|---|
| Molecular weight | 433.3 g/mol |
| IUPAC name | benzyl(triphenyl)phosphanium bromide |
| InChIKey | WTEPWWCRWNCUNA-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)C[P+](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4.[Br-] |
Computed by PubChem (NCBI)