CAS 1449117-45-6 is the registry number for 2-Chloroethyl 2,4-dichloro-7,8-dihydropyrido[4,3-d]pyrimidine-6(5h)-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-chloroethyl 2,4-dichloro-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxylate (CAS 1449117-45-6) is a chemical compound with the molecular formula C10H10Cl3N3O2 and a molecular weight of 310.6 g/mol. IUPAC name: 2-chloroethyl 2,4-dichloro-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxylate. InChIKey: XTPGBWKSANWNCN-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl3N3O2 |
|---|---|
| Molecular weight | 310.6 g/mol |
| IUPAC name | 2-chloroethyl 2,4-dichloro-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxylate |
| InChIKey | XTPGBWKSANWNCN-UHFFFAOYSA-N |
| SMILES | C1CN(CC2=C1N=C(N=C2Cl)Cl)C(=O)OCCCl |
Computed by PubChem (NCBI)