CAS 14494-37-2 appears in our catalog under these names: Cu(ii) protoporphyrin ix, 95%, Copper(II)-protoporphyrin IX, Cu(II) protoporphyrin IX, Cu(II) protoporphyrin IX, ≥95%, ≥95%, Cu(II) protoporphyrin IX, 95.60%. Offered by: Combi-blocks, TRC, AmBeed, GLPBio, Chemat. Available pack sizes: 250mg, 100mg, 50mg, 10mg, 5mg, 25mg, 5 mg, 10 mg.
Copper 3-[18-(2-carboxyethyl)-7,12-bis(ethenyl)-3,8,13,17-tetramethylporphyrin-21,23-diid-2-yl]propanoic acid (CAS 14494-37-2) is a chemical compound with the molecular formula C34H32CuN4O4 and a molecular weight of 624.2 g/mol. IUPAC name: copper 3-[18-(2-carboxyethyl)-7,12-bis(ethenyl)-3,8,13,17-tetramethylporphyrin-21,23-diid-2-yl]propanoic acid. InChIKey: ASFPSNQTLAUXFI-UHFFFAOYSA-L.
| Molecular formula | C34H32CuN4O4 |
|---|---|
| Molecular weight | 624.2 g/mol |
| IUPAC name | copper 3-[18-(2-carboxyethyl)-7,12-bis(ethenyl)-3,8,13,17-tetramethylporphyrin-21,23-diid-2-yl]propanoic acid |
| InChIKey | ASFPSNQTLAUXFI-UHFFFAOYSA-L |
| SMILES | CC1=C(C2=CC3=NC(=CC4=C(C(=C([N-]4)C=C5C(=C(C(=N5)C=C1[N-]2)C=C)C)C=C)C)C(=C3CCC(=O)O)C)CCC(=O)O.[Cu+2] |
Computed by PubChem (NCBI)