CAS 1449401-87-9 appears in our catalog under these names: 8–Bromo–5–phenyl–5H–pyrido(3,2–b)indole, 8-Bromo-5-phenyl-5H-pyrido[3,2-b]indole, >95.0%(GC), 8-Bromo-5-phenyl-5H-pyrido[3,2-b]indole, 95%, 95%. Offered by: GLPBio, TCI, Chemat. Available pack sizes: 1g, 200mg, 100mg, 250mg, 500mg.
8-bromo-5-phenylpyrido[3,2-b]indole (CAS 1449401-87-9) is a chemical compound with the molecular formula C17H11BrN2 and a molecular weight of 323.2 g/mol. IUPAC name: 8-bromo-5-phenylpyrido[3,2-b]indole. InChIKey: GDDKUPWTOMOOMB-UHFFFAOYSA-N.
| Molecular formula | C17H11BrN2 |
|---|---|
| Molecular weight | 323.2 g/mol |
| IUPAC name | 8-bromo-5-phenylpyrido[3,2-b]indole |
| InChIKey | GDDKUPWTOMOOMB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C3=C(C4=C2C=CC(=C4)Br)N=CC=C3 |
Computed by PubChem (NCBI)