Products 1449470-38-5
CAS 1449470-38-5 is the registry number for Antioxidant/anticancer agent 1. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[(E)-(4-methoxy-6-methylpyrimidin-2-yl)iminomethyl]naphthalen-2-ol (CAS 1449470-38-5) is a chemical compound with the molecular formula C17H15N3O2 and a molecular weight of 293.32 g/mol. IUPAC name: 3-[(E)-(4-methoxy-6-methylpyrimidin-2-yl)iminomethyl]naphthalen-2-ol. InChIKey: VTVJTUYAKKSLLE-VCHYOVAHSA-N.
| Molecular formula | C17H15N3O2 |
|---|---|
| Molecular weight | 293.32 g/mol |
| IUPAC name | 3-[(E)-(4-methoxy-6-methylpyrimidin-2-yl)iminomethyl]naphthalen-2-ol |
| InChIKey | VTVJTUYAKKSLLE-VCHYOVAHSA-N |
| SMILES | CC1=CC(=NC(=N1)/N=C/C2=CC3=CC=CC=C3C=C2O)OC |
Computed by PubChem (NCBI)