Products 30334-04-4
CAS 30334-04-4 is the registry number for d-6-Cyano-6-norlysergic Acid Methyl Ester. Offered by: TRC. Available pack sizes: 50mg.
Methyl 7-cyano-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxylate (CAS 30334-04-4) is a chemical compound with the molecular formula C17H15N3O2 and a molecular weight of 293.32 g/mol. IUPAC name: methyl 7-cyano-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxylate. InChIKey: OINOBHAOIREOCN-UHFFFAOYSA-N.
| Molecular formula | C17H15N3O2 |
|---|---|
| Molecular weight | 293.32 g/mol |
| IUPAC name | methyl 7-cyano-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxylate |
| InChIKey | OINOBHAOIREOCN-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CN(C2CC3=CNC4=CC=CC(=C34)C2=C1)C#N |
Computed by PubChem (NCBI)