CAS 1449473-97-5 appears in our catalog under these names: PF–06305591, PF-06305591, 99%, PF-06305591/ 99.88% (existing batch purity), PF-06305591, PF-06305591, 99.74%. Offered by: GLPBio, AmBeed, TargetMol, Biosynth, Chemat. Available pack sizes: 5mg, 100mg, 1mg, 10mg, 25mg, 50mg, 500mg, 50 mg.
(2R,3S)-3-amino-3-(6-tert-butyl-1H-benzimidazol-2-yl)-2-methylpropanamide (CAS 1449473-97-5) is a chemical compound with the molecular formula C15H22N4O and a molecular weight of 274.36 g/mol. IUPAC name: (2R,3S)-3-amino-3-(6-tert-butyl-1H-benzimidazol-2-yl)-2-methylpropanamide. InChIKey: APWZIFIAVVFPNT-PELKAZGASA-N.
| Molecular formula | C15H22N4O |
|---|---|
| Molecular weight | 274.36 g/mol |
| IUPAC name | (2R,3S)-3-amino-3-(6-tert-butyl-1H-benzimidazol-2-yl)-2-methylpropanamide |
| InChIKey | APWZIFIAVVFPNT-PELKAZGASA-N |
| SMILES | C[C@H]([C@@H](C1=NC2=C(N1)C=C(C=C2)C(C)(C)C)N)C(=O)N |
Computed by PubChem (NCBI)