CAS 1449509-64-1 is the registry number for Naphthalen-2-yl-(2-pyridin-3-ylbenzimidazol-1-yl)methanone. Offered by: Biosynth. Available pack sizes: 1000mg, 5000mg.
Naphthalen-2-yl-(2-pyridin-3-ylbenzimidazol-1-yl)methanone (CAS 1449509-64-1) is a chemical compound with the molecular formula C23H15N3O and a molecular weight of 349.4 g/mol. IUPAC name: naphthalen-2-yl-(2-pyridin-3-ylbenzimidazol-1-yl)methanone. InChIKey: LYSXGIIGTSCKRR-UHFFFAOYSA-N.
| Molecular formula | C23H15N3O |
|---|---|
| Molecular weight | 349.4 g/mol |
| IUPAC name | naphthalen-2-yl-(2-pyridin-3-ylbenzimidazol-1-yl)methanone |
| InChIKey | LYSXGIIGTSCKRR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C(=O)N3C4=CC=CC=C4N=C3C5=CN=CC=C5 |
Computed by PubChem (NCBI)