CAS 1449521-09-8 is the registry number for 2-(2,2-Difluoroethenyl)-1-benzofuran, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
2-(2,2-difluoroethenyl)-1-benzofuran (CAS 1449521-09-8) is a chemical compound with the molecular formula C10H6F2O and a molecular weight of 180.15 g/mol. IUPAC name: 2-(2,2-difluoroethenyl)-1-benzofuran. InChIKey: CUJOADXOURCPON-UHFFFAOYSA-N.
| Molecular formula | C10H6F2O |
|---|---|
| Molecular weight | 180.15 g/mol |
| IUPAC name | 2-(2,2-difluoroethenyl)-1-benzofuran |
| InChIKey | CUJOADXOURCPON-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(O2)C=C(F)F |
Computed by PubChem (NCBI)