CAS 1449551-03-4 appears in our catalog under these names: Bis(3,4,5-trifluorophenyl)methanone, 95+%, Bis(3,4,5-trifluorophenyl)methanone. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
Bis(3,4,5-trifluorophenyl)methanone (CAS 1449551-03-4) is a chemical compound with the molecular formula C13H4F6O and a molecular weight of 290.16 g/mol. IUPAC name: bis(3,4,5-trifluorophenyl)methanone. InChIKey: HIFSKWKVYRHUFU-UHFFFAOYSA-N.
| Molecular formula | C13H4F6O |
|---|---|
| Molecular weight | 290.16 g/mol |
| IUPAC name | bis(3,4,5-trifluorophenyl)methanone |
| InChIKey | HIFSKWKVYRHUFU-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)F)F)C(=O)C2=CC(=C(C(=C2)F)F)F |
Computed by PubChem (NCBI)