Products 1449581-01-4
CAS 1449581-01-4 appears in our catalog under these names: 1H-Indole, 5,7-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-, 97%, 97%, 5,7-Dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 25mg, 100mg, 250mg, 500mg.
5,7-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole (CAS 1449581-01-4) is a chemical compound with the molecular formula C16H22BNO2 and a molecular weight of 271.2 g/mol. IUPAC name: 5,7-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole. InChIKey: AULSWMPEOQRZKW-UHFFFAOYSA-N.
| Molecular formula | C16H22BNO2 |
|---|---|
| Molecular weight | 271.2 g/mol |
| IUPAC name | 5,7-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole |
| InChIKey | AULSWMPEOQRZKW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3C=CNC3=C(C=C2C)C |
Computed by PubChem (NCBI)