CAS 144981-85-1 appears in our catalog under these names: 2–Iodo–9,9–dimethylfluorene, 2-Iodo-9,9-dimethylfluorene, >98.0%(GC), 2-Iodo-9,9-dimethyl-9H-fluorene 98%, 2-Iodo-9,9-dimethyl-9H-fluorene 98% HPLC, 2-Iodo-9,9-dimethyl-9H-fluorene, 98%, 98%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 5g, 1g, 10g.
2-iodo-9,9-dimethylfluorene (CAS 144981-85-1) is a chemical compound with the molecular formula C15H13I and a molecular weight of 320.17 g/mol. IUPAC name: 2-iodo-9,9-dimethylfluorene. InChIKey: DVLSJPCXPNKPRJ-UHFFFAOYSA-N.
| Molecular formula | C15H13I |
|---|---|
| Molecular weight | 320.17 g/mol |
| IUPAC name | 2-iodo-9,9-dimethylfluorene |
| InChIKey | DVLSJPCXPNKPRJ-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC=CC=C2C3=C1C=C(C=C3)I)C |
Computed by PubChem (NCBI)