CAS 144981-86-2 appears in our catalog under these names: 2,7-Diiodo-9,9-dimethylfluorene, 98%, 2,7–Diiodo–9,9–dimethylfluorene, 2,7-Diiodo-9,9-dimethylfluorene, >98.0%(GC), 2,7-Diiodo-9,9-dimethyl-9H-fluorene, 97%, 97%, 2,7-Diiodo-9,9-dimethyl-9H-fluorene, 97%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
2,7-diiodo-9,9-dimethylfluorene (CAS 144981-86-2) is a chemical compound with the molecular formula C15H12I2 and a molecular weight of 446.06 g/mol. IUPAC name: 2,7-diiodo-9,9-dimethylfluorene. InChIKey: GYOWFFGLGGCYSQ-UHFFFAOYSA-N.
| Molecular formula | C15H12I2 |
|---|---|
| Molecular weight | 446.06 g/mol |
| IUPAC name | 2,7-diiodo-9,9-dimethylfluorene |
| InChIKey | GYOWFFGLGGCYSQ-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=CC(=C2)I)C3=C1C=C(C=C3)I)C |
Computed by PubChem (NCBI)