CAS 145-48-2 is the registry number for 1,4-Dihydroxyanthraquinone-2-sulfonic acid. Offered by: Biosynth. Available pack sizes: 10g.
1,4-dihydroxy-9,10-dioxoanthracene-2-sulfonic acid (CAS 145-48-2) is a chemical compound with the molecular formula C14H8O7S and a molecular weight of 320.28 g/mol. IUPAC name: 1,4-dihydroxy-9,10-dioxoanthracene-2-sulfonic acid. InChIKey: CCQSBGJULPBARL-UHFFFAOYSA-N.
| Molecular formula | C14H8O7S |
|---|---|
| Molecular weight | 320.28 g/mol |
| IUPAC name | 1,4-dihydroxy-9,10-dioxoanthracene-2-sulfonic acid |
| InChIKey | CCQSBGJULPBARL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=C(C2=O)C(=C(C=C3O)S(=O)(=O)O)O |
Computed by PubChem (NCBI)