CAS 1450-93-7 appears in our catalog under these names: 2-Aminoimidazole Sulfate, 2–Aminoimidazole sulfate, 2-Aminoimidazole sulfate, 98% , 2-Aminoimidazole Sulfate, >98.0%(HPLC)(T), 2-Aminoimidazole hemisulfate, 98+%. Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, TCI. Available pack sizes: 10g, 1g, 2,5g, 100g, 500g, 25g, 5g, 2.5g.
Bis(1H-imidazol-2-amine);sulfuric acid (CAS 1450-93-7) is a chemical compound with the molecular formula C6H12N6O4S and a molecular weight of 264.27 g/mol. IUPAC name: bis(1H-imidazol-2-amine);sulfuric acid. InChIKey: KUWRLKJYNASPQZ-UHFFFAOYSA-N.
| Molecular formula | C6H12N6O4S |
|---|---|
| Molecular weight | 264.27 g/mol |
| IUPAC name | bis(1H-imidazol-2-amine);sulfuric acid |
| InChIKey | KUWRLKJYNASPQZ-UHFFFAOYSA-N |
| SMILES | C1=CN=C(N1)N.C1=CN=C(N1)N.OS(=O)(=O)O |
Computed by PubChem (NCBI)