Products 1450635-01-4
CAS 1450635-01-4 is the registry number for tert-butyl (2R,3S)-2-(aminomethyl)-3-hydroxypyrrolidine-1-carboxylate, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Tert-butyl (2R,3S)-2-(aminomethyl)-3-hydroxypyrrolidine-1-carboxylate (CAS 1450635-01-4) is a chemical compound with the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. IUPAC name: tert-butyl (2R,3S)-2-(aminomethyl)-3-hydroxypyrrolidine-1-carboxylate. InChIKey: SSPONZFWUHWNBI-SFYZADRCSA-N.
| Molecular formula | C10H20N2O3 |
|---|---|
| Molecular weight | 216.28 g/mol |
| IUPAC name | tert-butyl (2R,3S)-2-(aminomethyl)-3-hydroxypyrrolidine-1-carboxylate |
| InChIKey | SSPONZFWUHWNBI-SFYZADRCSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H]([C@H]1CN)O |
Computed by PubChem (NCBI)