CAS 1450638-17-1 appears in our catalog under these names: 4,4,5,5-Tetramethyl-2-(2,2,2-trifluoroethyl)-1,3,2-dioxaborolane, 98%, 98%, 4,4,5,5-Tetramethyl-2-(2,2,2-trifluoroethyl)-1,3,2-dioxaborolane, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
4,4,5,5-tetramethyl-2-(2,2,2-trifluoroethyl)-1,3,2-dioxaborolane (CAS 1450638-17-1) is a chemical compound with the molecular formula C8H14BF3O2 and a molecular weight of 210.00 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(2,2,2-trifluoroethyl)-1,3,2-dioxaborolane. InChIKey: TVADKTGPYJJVQL-UHFFFAOYSA-N.
| Molecular formula | C8H14BF3O2 |
|---|---|
| Molecular weight | 210.00 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(2,2,2-trifluoroethyl)-1,3,2-dioxaborolane |
| InChIKey | TVADKTGPYJJVQL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CC(F)(F)F |
Computed by PubChem (NCBI)