CAS 145079-53-4 is the registry number for 4-Methylphenyl 2,3,4-tri-O-benzyl-1-thio-β-D-xylopyranoside. Offered by: Chemat. Available pack sizes: 10g, 1g, 2g, 500mg, 5g.
(2S,3R,4S,5R)-2-(4-methylphenyl)sulfanyl-3,4,5-tris(phenylmethoxy)oxane (CAS 145079-53-4) is a chemical compound with the molecular formula C33H34O4S and a molecular weight of 526.7 g/mol. IUPAC name: (2S,3R,4S,5R)-2-(4-methylphenyl)sulfanyl-3,4,5-tris(phenylmethoxy)oxane. InChIKey: YGVXQBHDXUIBTE-LVVLYVGBSA-N.
| Molecular formula | C33H34O4S |
|---|---|
| Molecular weight | 526.7 g/mol |
| IUPAC name | (2S,3R,4S,5R)-2-(4-methylphenyl)sulfanyl-3,4,5-tris(phenylmethoxy)oxane |
| InChIKey | YGVXQBHDXUIBTE-LVVLYVGBSA-N |
| SMILES | CC1=CC=C(C=C1)S[C@H]2[C@@H]([C@H]([C@@H](CO2)OCC3=CC=CC=C3)OCC4=CC=CC=C4)OCC5=CC=CC=C5 |
Computed by PubChem (NCBI)