CAS 145090-14-8 appears in our catalog under these names: H–Ala–Phe–pNA · HCl, H-Ala-Phe-pNA·HCl. Offered by: GLPBio, Biosynth. Available pack sizes: 250mg, 50mg, 100mg, 500mg.
(2S)-2-[[(2S)-2-aminopropanoyl]amino]-N-(4-nitrophenyl)-3-phenylpropanamide;hydrochloride (CAS 145090-14-8) is a chemical compound with the molecular formula C18H21ClN4O4 and a molecular weight of 392.8 g/mol. IUPAC name: (2S)-2-[[(2S)-2-aminopropanoyl]amino]-N-(4-nitrophenyl)-3-phenylpropanamide;hydrochloride. InChIKey: OBNNFOIYTLLBKJ-MIRNQTQTSA-N.
| Molecular formula | C18H21ClN4O4 |
|---|---|
| Molecular weight | 392.8 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2-aminopropanoyl]amino]-N-(4-nitrophenyl)-3-phenylpropanamide;hydrochloride |
| InChIKey | OBNNFOIYTLLBKJ-MIRNQTQTSA-N |
| SMILES | C[C@@H](C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)NC2=CC=C(C=C2)[N+](=O)[O-])N.Cl |
Computed by PubChem (NCBI)