CAS 1450903-25-9 is the registry number for Cis-2-(4-fluorophenyl)cyclopropan-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Cis-(1R,2R)-2-(4-fluorophenyl)cyclopropan-1-amine (CAS 1450903-25-9) is a chemical compound with the molecular formula C9H10FN and a molecular weight of 151.18 g/mol. IUPAC name: cis-(1R,2R)-2-(4-fluorophenyl)cyclopropan-1-amine. InChIKey: GTYFDGYGRFJTKJ-RKDXNWHRSA-N.
| Molecular formula | C9H10FN |
|---|---|
| Molecular weight | 151.18 g/mol |
| IUPAC name | cis-(1R,2R)-2-(4-fluorophenyl)cyclopropan-1-amine |
| InChIKey | GTYFDGYGRFJTKJ-RKDXNWHRSA-N |
| SMILES | C1[C@@H]([C@@H]1N)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)