CAS 1450904-92-3 appears in our catalog under these names: Lemborexant Impurity 4, ((1R,2S)-2-(3-Fluorophenyl)-2-((tosyloxy)methyl)cyclopropyl)methyl acetate, 95%, 95%. Offered by: GLPBio, Chemat. Available pack sizes: 1mg, 100mg, 250mg, 1g, 5g, 10g.
[(1R,2S)-2-(3-fluorophenyl)-2-[(4-methylphenyl)sulfonyloxymethyl]cyclopropyl]methyl acetate (CAS 1450904-92-3) is a chemical compound with the molecular formula C20H21FO5S and a molecular weight of 392.4 g/mol. IUPAC name: [(1R,2S)-2-(3-fluorophenyl)-2-[(4-methylphenyl)sulfonyloxymethyl]cyclopropyl]methyl acetate. InChIKey: SKZOOQSXAWLLOW-FXAWDEMLSA-N.
| Molecular formula | C20H21FO5S |
|---|---|
| Molecular weight | 392.4 g/mol |
| IUPAC name | [(1R,2S)-2-(3-fluorophenyl)-2-[(4-methylphenyl)sulfonyloxymethyl]cyclopropyl]methyl acetate |
| InChIKey | SKZOOQSXAWLLOW-FXAWDEMLSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC[C@]2(C[C@H]2COC(=O)C)C3=CC(=CC=C3)F |
Computed by PubChem (NCBI)