CAS 1450912-63-6 appears in our catalog under these names: Sodiumdifluoroheptylazidosulfinate-95%,,, Difluoroheptylazidosulfinate (sodium). Offered by: Chemat, MedChemExpress. Available pack sizes: 100mg, 10 mg, 25 mg, 50 mg, 5 mg, 100 mg.
Sodium 7-azido-1,1-difluoroheptane-1-sulfinate (CAS 1450912-63-6) is a chemical compound with the molecular formula C7H12F2N3NaO2S and a molecular weight of 263.24 g/mol. IUPAC name: sodium 7-azido-1,1-difluoroheptane-1-sulfinate. InChIKey: FFNHIEJQAMGBCZ-UHFFFAOYSA-M.
| Molecular formula | C7H12F2N3NaO2S |
|---|---|
| Molecular weight | 263.24 g/mol |
| IUPAC name | sodium 7-azido-1,1-difluoroheptane-1-sulfinate |
| InChIKey | FFNHIEJQAMGBCZ-UHFFFAOYSA-M |
| SMILES | C(CCCN=[N+]=[N-])CCC(F)(F)S(=O)[O-].[Na+] |
Computed by PubChem (NCBI)