CAS 1451194-68-5 appears in our catalog under these names: α–Linolenoyl Ethanolamide–d4, alpha-Linolenoyl Ethanolamide-d4, N-Linolenoylethanolamine-d4. Offered by: GLPBio, TRC, MedChemExpress. Available pack sizes: 5mg, 10mg, 1mg, 100μg, 500μg, 100 μg.
(9Z,12Z,15Z)-N-(1,1,2,2-tetradeuterio-2-hydroxyethyl)octadeca-9,12,15-trienamide (CAS 1451194-68-5) is a chemical compound with the molecular formula C20H35NO2 and a molecular weight of 325.5 g/mol. IUPAC name: (9Z,12Z,15Z)-N-(1,1,2,2-tetradeuterio-2-hydroxyethyl)octadeca-9,12,15-trienamide. InChIKey: HBJXRRXWHSHZPU-BBVLJAKGSA-N.
| Molecular formula | C20H35NO2 |
|---|---|
| Molecular weight | 325.5 g/mol |
| IUPAC name | (9Z,12Z,15Z)-N-(1,1,2,2-tetradeuterio-2-hydroxyethyl)octadeca-9,12,15-trienamide |
| InChIKey | HBJXRRXWHSHZPU-BBVLJAKGSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])O)NC(=O)CCCCCCC/C=C\C/C=C\C/C=C\CC |
Computed by PubChem (NCBI)