CAS 1451391-13-1 appears in our catalog under these names: 5-Bromo-2-fluoro-3-formylphenylboronic acid, pinacol ester, 95%, 5-Bromo-2-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
5-bromo-2-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde (CAS 1451391-13-1) is a chemical compound with the molecular formula C13H15BBrFO3 and a molecular weight of 328.97 g/mol. IUPAC name: 5-bromo-2-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde. InChIKey: TVFZPXFWYIDRSU-UHFFFAOYSA-N.
| Molecular formula | C13H15BBrFO3 |
|---|---|
| Molecular weight | 328.97 g/mol |
| IUPAC name | 5-bromo-2-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde |
| InChIKey | TVFZPXFWYIDRSU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2F)C=O)Br |
Computed by PubChem (NCBI)