CAS 1451391-44-8 appears in our catalog under these names: 4-(Dibenzylamino)-2,6-dimethylphenylboronic acid, 95%, (4-(Dibenzylamino)-2,6-dimethylphenyl)boronic acid, 98+%, 4-(Dibenzylamino)-2,6-dimethylphenylboronic acid. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
[4-(dibenzylamino)-2,6-dimethylphenyl]boronic acid (CAS 1451391-44-8) is a chemical compound with the molecular formula C22H24BNO2 and a molecular weight of 345.2 g/mol. IUPAC name: [4-(dibenzylamino)-2,6-dimethylphenyl]boronic acid. InChIKey: UOILFPHQODZYGP-UHFFFAOYSA-N.
| Molecular formula | C22H24BNO2 |
|---|---|
| Molecular weight | 345.2 g/mol |
| IUPAC name | [4-(dibenzylamino)-2,6-dimethylphenyl]boronic acid |
| InChIKey | UOILFPHQODZYGP-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1C)N(CC2=CC=CC=C2)CC3=CC=CC=C3)C)(O)O |
Computed by PubChem (NCBI)