Products 1451391-80-2

CAS 1451391-80-2 is the registry number for 5-Fluoro-2-(morpholinomethyl)phenylboronic acid hydrochloride, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

[5-fluoro-2-(morpholin-4-ylmethyl)phenyl]boronic acid;hydrochloride (CAS 1451391-80-2) is a chemical compound with the molecular formula C11H16BClFNO3 and a molecular weight of 275.51 g/mol. IUPAC name: [5-fluoro-2-(morpholin-4-ylmethyl)phenyl]boronic acid;hydrochloride. InChIKey: PMNHTRQBVOIROF-UHFFFAOYSA-N.

Identity
Molecular formulaC11H16BClFNO3
Molecular weight275.51 g/mol
IUPAC name[5-fluoro-2-(morpholin-4-ylmethyl)phenyl]boronic acid;hydrochloride
InChIKeyPMNHTRQBVOIROF-UHFFFAOYSA-N
SMILESB(C1=C(C=CC(=C1)F)CN2CCOCC2)(O)O.Cl

Computed by PubChem (NCBI)