Products 1451392-22-5
CAS 1451392-22-5 appears in our catalog under these names: 4-Methoxy-2-(methoxymethyl)phenylboronic acid, 95%, 4–Methoxy–2–(methoxymethyl)phenylboronic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g.
[4-methoxy-2-(methoxymethyl)phenyl]boronic acid (CAS 1451392-22-5) is a chemical compound with the molecular formula C9H13BO4 and a molecular weight of 196.01 g/mol. IUPAC name: [4-methoxy-2-(methoxymethyl)phenyl]boronic acid. InChIKey: FXLRYELPUQTVJS-UHFFFAOYSA-N.
| Molecular formula | C9H13BO4 |
|---|---|
| Molecular weight | 196.01 g/mol |
| IUPAC name | [4-methoxy-2-(methoxymethyl)phenyl]boronic acid |
| InChIKey | FXLRYELPUQTVJS-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)OC)COC)(O)O |
Computed by PubChem (NCBI)