CAS 1451392-26-9 appears in our catalog under these names: 2-Chloro-6-fluoro-3-(methoxymethoxy)phenylboronic acid, 98%, (2-Chloro-6-fluoro-3-(methoxymethoxy)phenyl)boronic acid, 95+%, 2-Chloro-6-fluoro-3-(methoxymethoxy)phenylboronic acid. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g.
[2-chloro-6-fluoro-3-(methoxymethoxy)phenyl]boronic acid (CAS 1451392-26-9) is a chemical compound with the molecular formula C8H9BClFO4 and a molecular weight of 234.42 g/mol. IUPAC name: [2-chloro-6-fluoro-3-(methoxymethoxy)phenyl]boronic acid. InChIKey: HEHSNQNHNZDAGM-UHFFFAOYSA-N.
| Molecular formula | C8H9BClFO4 |
|---|---|
| Molecular weight | 234.42 g/mol |
| IUPAC name | [2-chloro-6-fluoro-3-(methoxymethoxy)phenyl]boronic acid |
| InChIKey | HEHSNQNHNZDAGM-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1Cl)OCOC)F)(O)O |
Computed by PubChem (NCBI)