Products 1451392-29-2

CAS 1451392-29-2 appears in our catalog under these names: 2,5-Difluoro-4-(methoxymethoxy)phenylboronic acid, 95%, (2,5-Difluoro-4-(methoxymethoxy)phenyl)boronic acid, 98%, 2,5-Difluoro-4-(methoxymethoxy)phenylboronic acid. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.

Structural formula: {0} (CAS {1})

[2,5-difluoro-4-(methoxymethoxy)phenyl]boronic acid (CAS 1451392-29-2) is a chemical compound with the molecular formula C8H9BF2O4 and a molecular weight of 217.96 g/mol. IUPAC name: [2,5-difluoro-4-(methoxymethoxy)phenyl]boronic acid. InChIKey: XQIXENAYGSXYMJ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H9BF2O4
Molecular weight217.96 g/mol
IUPAC name[2,5-difluoro-4-(methoxymethoxy)phenyl]boronic acid
InChIKeyXQIXENAYGSXYMJ-UHFFFAOYSA-N
SMILESB(C1=CC(=C(C=C1F)OCOC)F)(O)O

Computed by PubChem (NCBI)