Products 1451392-81-6
CAS 1451392-81-6 appears in our catalog under these names: 2-Brom-6-fluoro-3-formylphenylboronic acid, 2-Brom-6-fluoro-3-formylphenylboronic acid, 97%, (2-Bromo-6-fluoro-3-formylphenyl)boronic acid, 98+%, 2-Brom-6-fluoro-3-formylphenylboronic acid, ≥95%, ≥95%. Offered by: Fluorochem, Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 5g, 250mg, 10g, 25g.
(2-bromo-6-fluoro-3-formylphenyl)boronic acid (CAS 1451392-81-6) is a chemical compound with the molecular formula C7H5BBrFO3 and a molecular weight of 246.83 g/mol. IUPAC name: (2-bromo-6-fluoro-3-formylphenyl)boronic acid. InChIKey: GASAVFGFZLEBHN-UHFFFAOYSA-N.
| Molecular formula | C7H5BBrFO3 |
|---|---|
| Molecular weight | 246.83 g/mol |
| IUPAC name | (2-bromo-6-fluoro-3-formylphenyl)boronic acid |
| InChIKey | GASAVFGFZLEBHN-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1Br)C=O)F)(O)O |
Computed by PubChem (NCBI)