CAS 1451393-14-8 appears in our catalog under these names: 3-Benzyloxy-4-bromo-2,6-difluorophenylboronic acid, 95%, (3-(Benzyloxy)-4-bromo-2,6-difluorophenyl)boronic acid, ≥95%, ≥95%, 3-Benzyloxy-4-bromo-2,6-difluorophenylboronic acid, 98+%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 10g, 5g, 25g, 1g.
(4-bromo-2,6-difluoro-3-phenylmethoxyphenyl)boronic acid (CAS 1451393-14-8) is a chemical compound with the molecular formula C13H10BBrF2O3 and a molecular weight of 342.93 g/mol. IUPAC name: (4-bromo-2,6-difluoro-3-phenylmethoxyphenyl)boronic acid. InChIKey: ZROLYOUHNLANTP-UHFFFAOYSA-N.
| Molecular formula | C13H10BBrF2O3 |
|---|---|
| Molecular weight | 342.93 g/mol |
| IUPAC name | (4-bromo-2,6-difluoro-3-phenylmethoxyphenyl)boronic acid |
| InChIKey | ZROLYOUHNLANTP-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1F)Br)OCC2=CC=CC=C2)F)(O)O |
Computed by PubChem (NCBI)