CAS 1451393-23-9 appears in our catalog under these names: 3,5-Bis(trifluoromethyl)-2-bromophenylboronic acid, 96%, (2-Bromo-3,5-bis(trifluoromethyl)phenyl)boronic acid 98+%, 3,5-Bis(trifluoromethyl)-2-bromophenylboronic acid, 98+%, 98+%, 3,5-Bis(trifluoromethyl)-2-bromophenylboronic acid, >=95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 10g, 5g, 25g, 1g, 100mg.
[2-bromo-3,5-bis(trifluoromethyl)phenyl]boronic acid (CAS 1451393-23-9) is a chemical compound with the molecular formula C8H4BBrF6O2 and a molecular weight of 336.82 g/mol. IUPAC name: [2-bromo-3,5-bis(trifluoromethyl)phenyl]boronic acid. InChIKey: HTTRUFHCNMHBPG-UHFFFAOYSA-N.
| Molecular formula | C8H4BBrF6O2 |
|---|---|
| Molecular weight | 336.82 g/mol |
| IUPAC name | [2-bromo-3,5-bis(trifluoromethyl)phenyl]boronic acid |
| InChIKey | HTTRUFHCNMHBPG-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1Br)C(F)(F)F)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)