CAS 1451393-28-4 appears in our catalog under these names: 3-(3,5-Dichlorophenylcarbamoyl)-4-fluorophenylboronic acid, 3-(3,5-Dichlorophenylcarbamoyl)-4-fluorophenylboronic acid, 97%, (3-((3,5-Dichlorophenyl)carbamoyl)-4-fluorophenyl)boronic acid, 98+%. Offered by: Fluorochem, Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg, 10g, 25g.
[3-[(3,5-dichlorophenyl)carbamoyl]-4-fluorophenyl]boronic acid (CAS 1451393-28-4) is a chemical compound with the molecular formula C13H9BCl2FNO3 and a molecular weight of 327.9 g/mol. IUPAC name: [3-[(3,5-dichlorophenyl)carbamoyl]-4-fluorophenyl]boronic acid. InChIKey: HRLQHZOOWBUTLV-UHFFFAOYSA-N.
| Molecular formula | C13H9BCl2FNO3 |
|---|---|
| Molecular weight | 327.9 g/mol |
| IUPAC name | [3-[(3,5-dichlorophenyl)carbamoyl]-4-fluorophenyl]boronic acid |
| InChIKey | HRLQHZOOWBUTLV-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)F)C(=O)NC2=CC(=CC(=C2)Cl)Cl)(O)O |
Computed by PubChem (NCBI)