CAS 1451393-29-5 appears in our catalog under these names: 3-(3-Chloro-4-fluorophenylcarbamoyl)-4-fluorophenylboronic acid, 97%, (3-((3-Chloro-4-fluorophenyl)carbamoyl)-4-fluorophenyl)boronic acid, 98+%, 3-(3-Chloro-4-fluorophenylcarbamoyl)-4-fluorophenylboronic acid. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 250mg, 10g, 5g, 25g, 1g.
[3-[(3-chloro-4-fluorophenyl)carbamoyl]-4-fluorophenyl]boronic acid (CAS 1451393-29-5) is a chemical compound with the molecular formula C13H9BClF2NO3 and a molecular weight of 311.48 g/mol. IUPAC name: [3-[(3-chloro-4-fluorophenyl)carbamoyl]-4-fluorophenyl]boronic acid. InChIKey: SUZZUSICZSSECK-UHFFFAOYSA-N.
| Molecular formula | C13H9BClF2NO3 |
|---|---|
| Molecular weight | 311.48 g/mol |
| IUPAC name | [3-[(3-chloro-4-fluorophenyl)carbamoyl]-4-fluorophenyl]boronic acid |
| InChIKey | SUZZUSICZSSECK-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)F)C(=O)NC2=CC(=C(C=C2)F)Cl)(O)O |
Computed by PubChem (NCBI)