CAS 1451393-52-4 appears in our catalog under these names: 3,5-Bis(trifluoromethyl)benzylboronic acid, 95%, (3,5-Bis(trifluoromethyl)benzyl)boronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 10g, 5g, 25g, 1g.
[3,5-bis(trifluoromethyl)phenyl]methylboronic acid (CAS 1451393-52-4) is a chemical compound with the molecular formula C9H7BF6O2 and a molecular weight of 271.95 g/mol. IUPAC name: [3,5-bis(trifluoromethyl)phenyl]methylboronic acid. InChIKey: REMKPLMTAFTLPK-UHFFFAOYSA-N.
| Molecular formula | C9H7BF6O2 |
|---|---|
| Molecular weight | 271.95 g/mol |
| IUPAC name | [3,5-bis(trifluoromethyl)phenyl]methylboronic acid |
| InChIKey | REMKPLMTAFTLPK-UHFFFAOYSA-N |
| SMILES | B(CC1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)