Products 145166-60-5
CAS 145166-60-5 is the registry number for H-Gly-L-Phe-pNA*HCl. Offered by: Iris Biotech. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 500mg, 1g, 5g.
(2S)-2-[(2-aminoacetyl)amino]-N-(4-nitrophenyl)-3-phenylpropanamide;hydrochloride (CAS 145166-60-5) is a chemical compound with the molecular formula C17H19ClN4O4 and a molecular weight of 378.8 g/mol. IUPAC name: (2S)-2-[(2-aminoacetyl)amino]-N-(4-nitrophenyl)-3-phenylpropanamide;hydrochloride. InChIKey: ZZBQBYJJHAJISV-RSAXXLAASA-N.
| Molecular formula | C17H19ClN4O4 |
|---|---|
| Molecular weight | 378.8 g/mol |
| IUPAC name | (2S)-2-[(2-aminoacetyl)amino]-N-(4-nitrophenyl)-3-phenylpropanamide;hydrochloride |
| InChIKey | ZZBQBYJJHAJISV-RSAXXLAASA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)NC2=CC=C(C=C2)[N+](=O)[O-])NC(=O)CN.Cl |
Computed by PubChem (NCBI)