Products 145193-69-7

CAS 145193-69-7 is the registry number for 8-Fluorocubane-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

4-fluorocubane-1-carboxylic acid (CAS 145193-69-7) is a chemical compound with the molecular formula C9H7FO2 and a molecular weight of 166.15 g/mol. IUPAC name: 4-fluorocubane-1-carboxylic acid. InChIKey: FYGVUKWGPSBFGD-UHFFFAOYSA-N.

Identity
Molecular formulaC9H7FO2
Molecular weight166.15 g/mol
IUPAC name4-fluorocubane-1-carboxylic acid
InChIKeyFYGVUKWGPSBFGD-UHFFFAOYSA-N
SMILESC12C3C4C1(C5C2C3(C45)F)C(=O)O

Computed by PubChem (NCBI)