CAS 1451998-56-3 appears in our catalog under these names: [4-(Pentafluoro-lambda6-sulfanyl)phenyl]methanamine hydrochloride, 95%, (4-(Pentafluoro-l6-sulfaneyl)phenyl)methanamine hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg.
[4-(pentafluoro-lambda6-sulfanyl)phenyl]methanamine;hydrochloride (CAS 1451998-56-3) is a chemical compound with the molecular formula C7H9ClF5NS and a molecular weight of 269.66 g/mol. IUPAC name: [4-(pentafluoro-lambda6-sulfanyl)phenyl]methanamine;hydrochloride. InChIKey: ZAICOMKDAYSVBB-UHFFFAOYSA-N.
| Molecular formula | C7H9ClF5NS |
|---|---|
| Molecular weight | 269.66 g/mol |
| IUPAC name | [4-(pentafluoro-lambda6-sulfanyl)phenyl]methanamine;hydrochloride |
| InChIKey | ZAICOMKDAYSVBB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN)S(F)(F)(F)(F)F.Cl |
Computed by PubChem (NCBI)