CAS 1452128-53-8 is the registry number for Avanafil Impurity 8. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
6-[(3-chloro-4-methoxyphenyl)methylamino]-2-oxo-N-(pyrimidin-2-ylmethyl)-1H-pyrimidine-5-carboxamide (CAS 1452128-53-8) is a chemical compound with the molecular formula C18H17ClN6O3 and a molecular weight of 400.8 g/mol. IUPAC name: 6-[(3-chloro-4-methoxyphenyl)methylamino]-2-oxo-N-(pyrimidin-2-ylmethyl)-1H-pyrimidine-5-carboxamide. InChIKey: CWPCMPSQJQCKNZ-UHFFFAOYSA-N.
| Molecular formula | C18H17ClN6O3 |
|---|---|
| Molecular weight | 400.8 g/mol |
| IUPAC name | 6-[(3-chloro-4-methoxyphenyl)methylamino]-2-oxo-N-(pyrimidin-2-ylmethyl)-1H-pyrimidine-5-carboxamide |
| InChIKey | CWPCMPSQJQCKNZ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)CNC2=C(C=NC(=O)N2)C(=O)NCC3=NC=CC=N3)Cl |
Computed by PubChem (NCBI)