CAS 1452166-15-2 is the registry number for 5-Bromo-2,3-dioxoindoline-7-carboxylic acid, 97%. Offered by: AmBeed. Available pack sizes: 1g.
5-bromo-2,3-dioxo-1H-indole-7-carboxylic acid (CAS 1452166-15-2) is a chemical compound with the molecular formula C9H4BrNO4 and a molecular weight of 270.04 g/mol. IUPAC name: 5-bromo-2,3-dioxo-1H-indole-7-carboxylic acid. InChIKey: UZKLVCWRNMAWFI-UHFFFAOYSA-N.
| Molecular formula | C9H4BrNO4 |
|---|---|
| Molecular weight | 270.04 g/mol |
| IUPAC name | 5-bromo-2,3-dioxo-1H-indole-7-carboxylic acid |
| InChIKey | UZKLVCWRNMAWFI-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1C(=O)C(=O)N2)C(=O)O)Br |
Computed by PubChem (NCBI)