Products 145238-17-1
CAS 145238-17-1 appears in our catalog under these names: Dibenzofuran-4,6-bis(boronic acid), 97%, 97%, Dibenzo[b,d]furan-4,6-diyldiboronic acid, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
(6-boronodibenzofuran-4-yl)boronic acid (CAS 145238-17-1) is a chemical compound with the molecular formula C12H10B2O5 and a molecular weight of 255.8 g/mol. IUPAC name: (6-boronodibenzofuran-4-yl)boronic acid. InChIKey: CNLVLSQUPFGERC-UHFFFAOYSA-N.
| Molecular formula | C12H10B2O5 |
|---|---|
| Molecular weight | 255.8 g/mol |
| IUPAC name | (6-boronodibenzofuran-4-yl)boronic acid |
| InChIKey | CNLVLSQUPFGERC-UHFFFAOYSA-N |
| SMILES | B(C1=C2C(=CC=C1)C3=CC=CC(=C3O2)B(O)O)(O)O |
Computed by PubChem (NCBI)
Synonyms:
Dibenzo[b,d]furan-4,6-diyldiboronic acid, Dibenzofuran-4,6-diborate, Dibenzofuran -4,6 -diborate, (6-Boronodibenzofuran-4-yl)boronic acid, Dibenzofuran-4,6-diboronic acid, Boronic acid, B,B'-4,6-dibenzofurandiylbis-, Dibenzofuran-4,6-bis(boronic acid), B,B'-4,6-Dibenzofurandiylbis-boronicacid, dibenzofuran-4,6-bis-(boronic acid), Dibenzo[b,d]furan-4,6-diboronic acid