CAS 1452575-84-6 appears in our catalog under these names: 2-Fluoro-3-bromo-5-carboxyphenylboronic acid, 95%, 3-Borono-5-bromo-4-fluorobenzoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 10g, 25g, 250mg.
3-borono-5-bromo-4-fluorobenzoic acid (CAS 1452575-84-6) is a chemical compound with the molecular formula C7H5BBrFO4 and a molecular weight of 262.83 g/mol. IUPAC name: 3-borono-5-bromo-4-fluorobenzoic acid. InChIKey: CTJDZRABMGZXBA-UHFFFAOYSA-N.
| Molecular formula | C7H5BBrFO4 |
|---|---|
| Molecular weight | 262.83 g/mol |
| IUPAC name | 3-borono-5-bromo-4-fluorobenzoic acid |
| InChIKey | CTJDZRABMGZXBA-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1F)Br)C(=O)O)(O)O |
Computed by PubChem (NCBI)