CAS 1452577-78-4 is the registry number for (1-(tert-Butoxycarbonyl)-5-chloro-1h-pyrrolo[3,2-b]pyridin-3-yl)boronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
[5-chloro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolo[3,2-b]pyridin-3-yl]boronic acid (CAS 1452577-78-4) is a chemical compound with the molecular formula C12H14BClN2O4 and a molecular weight of 296.52 g/mol. IUPAC name: [5-chloro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolo[3,2-b]pyridin-3-yl]boronic acid. InChIKey: FVVZLTHHMQQXQH-UHFFFAOYSA-N.
| Molecular formula | C12H14BClN2O4 |
|---|---|
| Molecular weight | 296.52 g/mol |
| IUPAC name | [5-chloro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolo[3,2-b]pyridin-3-yl]boronic acid |
| InChIKey | FVVZLTHHMQQXQH-UHFFFAOYSA-N |
| SMILES | B(C1=CN(C2=C1N=C(C=C2)Cl)C(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)