CAS 14528-64-4 appears in our catalog under these names: 4-Nitrocatechol sulfate dipotassium salt, 4-Nitrocatechol sulfate dipotassium salt, 98%, 4–Nitrocatechol Sulfate Dipotassium Salt Hydrate, 4-Nitrocatechol sulfate (dipotassium salt), 99.81%, 4-Nitrocatechol sulfate (dipotassium salt), 95%. Offered by: Biosynth, AmBeed, GLPBio, MedChemExpress, Fluorochem. Available pack sizes: 2g, 1g, 5g, 10g, 25g, 100mg, 500mg, 5 g.
Dipotassium;(5-nitro-2-oxidophenyl) sulfate (CAS 14528-64-4) is a chemical compound with the molecular formula C6H3K2NO7S and a molecular weight of 311.35 g/mol. IUPAC name: dipotassium;(5-nitro-2-oxidophenyl) sulfate. InChIKey: CKWWBDCAYRJAJB-UHFFFAOYSA-L.
| Molecular formula | C6H3K2NO7S |
|---|---|
| Molecular weight | 311.35 g/mol |
| IUPAC name | dipotassium;(5-nitro-2-oxidophenyl) sulfate |
| InChIKey | CKWWBDCAYRJAJB-UHFFFAOYSA-L |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])OS(=O)(=O)[O-])[O-].[K+].[K+] |
Computed by PubChem (NCBI)