CAS 1452829-48-9 is the registry number for Rel-ethyl (3R,5R)-5-(tert-butyl)thiomorpholine-3-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl (3R,5R)-5-tert-butylthiomorpholine-3-carboxylate (CAS 1452829-48-9) is a chemical compound with the molecular formula C11H21NO2S and a molecular weight of 231.36 g/mol. IUPAC name: ethyl (3R,5R)-5-tert-butylthiomorpholine-3-carboxylate. InChIKey: MXPKLLRBLLDQRJ-IUCAKERBSA-N.
| Molecular formula | C11H21NO2S |
|---|---|
| Molecular weight | 231.36 g/mol |
| IUPAC name | ethyl (3R,5R)-5-tert-butylthiomorpholine-3-carboxylate |
| InChIKey | MXPKLLRBLLDQRJ-IUCAKERBSA-N |
| SMILES | CCOC(=O)[C@@H]1CSC[C@H](N1)C(C)(C)C |
Computed by PubChem (NCBI)