CAS 14529-33-0 is the registry number for 1,1,1-Trifluoro-3-(thiophen-2-yl)propan-2-one, 95%. Offered by: AmBeed. Available pack sizes: 1g.
1,1,1-trifluoro-3-thiophen-2-ylpropan-2-one (CAS 14529-33-0) is a chemical compound with the molecular formula C7H5F3OS and a molecular weight of 194.18 g/mol. IUPAC name: 1,1,1-trifluoro-3-thiophen-2-ylpropan-2-one. InChIKey: NBKNXYCQJHKJEU-UHFFFAOYSA-N.
| Molecular formula | C7H5F3OS |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | 1,1,1-trifluoro-3-thiophen-2-ylpropan-2-one |
| InChIKey | NBKNXYCQJHKJEU-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)CC(=O)C(F)(F)F |
Computed by PubChem (NCBI)