CAS 145299-84-9 is the registry number for 1,1-Difluoro-4-phenylbutan-2-one, 95%. Offered by: AmBeed. Available pack sizes: 1g.
1,1-difluoro-4-phenylbutan-2-one (CAS 145299-84-9) is a chemical compound with the molecular formula C10H10F2O and a molecular weight of 184.18 g/mol. IUPAC name: 1,1-difluoro-4-phenylbutan-2-one. InChIKey: BHMNKCWIONOLTE-UHFFFAOYSA-N.
| Molecular formula | C10H10F2O |
|---|---|
| Molecular weight | 184.18 g/mol |
| IUPAC name | 1,1-difluoro-4-phenylbutan-2-one |
| InChIKey | BHMNKCWIONOLTE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCC(=O)C(F)F |
Computed by PubChem (NCBI)